CAS 434958-85-7 appears in our catalog under these names: N–Boc–5–hydroxyindole, N-Boc-5-Hydroxyindole 95%, N-Boc-5-Hydroxyindole, 95%, 95%, N-Boc-5-Hydroxyindole, 97%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 100mg, 250mg, 10g, 25g.
Tert-butyl 5-hydroxyindole-1-carboxylate (CAS 434958-85-7) is a chemical compound with the molecular formula C13H15NO3 and a molecular weight of 233.26 g/mol. IUPAC name: tert-butyl 5-hydroxyindole-1-carboxylate. InChIKey: BYFYKCHJFIWCPC-UHFFFAOYSA-N.
| Molecular formula | C13H15NO3 |
|---|---|
| Molecular weight | 233.26 g/mol |
| IUPAC name | tert-butyl 5-hydroxyindole-1-carboxylate |
| InChIKey | BYFYKCHJFIWCPC-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1C=CC2=C1C=CC(=C2)O |
Computed by PubChem (NCBI)