Products 436086-87-2

CAS 436086-87-2 is the registry number for 5-[(4-Nitro-1h-pyrazol-1-yl)methyl]-2-furoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 250mg.

Structural formula: {0} (CAS {1})

5-[(4-nitropyrazol-1-yl)methyl]furan-2-carboxylic acid (CAS 436086-87-2) is a chemical compound with the molecular formula C9H7N3O5 and a molecular weight of 237.17 g/mol. IUPAC name: 5-[(4-nitropyrazol-1-yl)methyl]furan-2-carboxylic acid. InChIKey: IBTMBLNQUGWDNZ-UHFFFAOYSA-N.

Identity
Molecular formulaC9H7N3O5
Molecular weight237.17 g/mol
IUPAC name5-[(4-nitropyrazol-1-yl)methyl]furan-2-carboxylic acid
InChIKeyIBTMBLNQUGWDNZ-UHFFFAOYSA-N
SMILESC1=C(OC(=C1)C(=O)O)CN2C=C(C=N2)[N+](=O)[O-]

Computed by PubChem (NCBI)