Products 73217-62-6
CAS 73217-62-6 is the registry number for (3-(4-Nitrophenyl)-1,2,4-oxadiazol-5-yl)methanediol. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
[3-(4-nitrophenyl)-1,2,4-oxadiazol-5-yl]methanediol (CAS 73217-62-6) is a chemical compound with the molecular formula C9H7N3O5 and a molecular weight of 237.17 g/mol. IUPAC name: [3-(4-nitrophenyl)-1,2,4-oxadiazol-5-yl]methanediol. InChIKey: PYJFHJFQSWQNOD-UHFFFAOYSA-N.
| Molecular formula | C9H7N3O5 |
|---|---|
| Molecular weight | 237.17 g/mol |
| IUPAC name | [3-(4-nitrophenyl)-1,2,4-oxadiazol-5-yl]methanediol |
| InChIKey | PYJFHJFQSWQNOD-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=NOC(=N2)C(O)O)[N+](=O)[O-] |
Computed by PubChem (NCBI)