Products 436088-83-4
CAS 436088-83-4 is the registry number for 3-Amino-5-fluoro-1 H -indole-2-carboxylic acid methyl ester, 95+%. Offered by: Fluorochem. Available pack sizes: 1g.
Methyl 3-amino-5-fluoro-1H-indole-2-carboxylate (CAS 436088-83-4) is a chemical compound with the molecular formula C10H9FN2O2 and a molecular weight of 208.19 g/mol. IUPAC name: methyl 3-amino-5-fluoro-1H-indole-2-carboxylate. InChIKey: NPLGYDWUOAONMC-UHFFFAOYSA-N.
| Molecular formula | C10H9FN2O2 |
|---|---|
| Molecular weight | 208.19 g/mol |
| IUPAC name | methyl 3-amino-5-fluoro-1H-indole-2-carboxylate |
| InChIKey | NPLGYDWUOAONMC-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C2=C(N1)C=CC(=C2)F)N |
Computed by PubChem (NCBI)