CAS 436089-01-9 is the registry number for N-(4-Amino-2-methylphenyl)propionamide, 97%. Offered by: AmBeed. Available pack sizes: 5g.
N-(4-amino-2-methylphenyl)propanamide (CAS 436089-01-9) is a chemical compound with the molecular formula C10H14N2O and a molecular weight of 178.23 g/mol. IUPAC name: N-(4-amino-2-methylphenyl)propanamide. InChIKey: XKIFOCOJJXDOAM-UHFFFAOYSA-N.
| Molecular formula | C10H14N2O |
|---|---|
| Molecular weight | 178.23 g/mol |
| IUPAC name | N-(4-amino-2-methylphenyl)propanamide |
| InChIKey | XKIFOCOJJXDOAM-UHFFFAOYSA-N |
| SMILES | CCC(=O)NC1=C(C=C(C=C1)N)C |
Computed by PubChem (NCBI)