CAS 436151-87-0 appears in our catalog under these names: 4-(2,3-Dihydro-1-benzofuran-5-yl)-1,3-thiazol-2-amine, 95%, 4-(2,3-Dihydrobenzofuran-5-yl)thiazol-2-amine, 97%, 4-(2,3-Dihydrobenzofuran-5-yl)-thiazol-2-ylamine. Offered by: Combi-blocks, AmBeed, Biosynth, Fluorochem. Available pack sizes: 10g, 5g, 1g, 250mg, 0,5g.
4-(2,3-dihydro-1-benzofuran-5-yl)-1,3-thiazol-2-amine (CAS 436151-87-0) is a chemical compound with the molecular formula C11H10N2OS and a molecular weight of 218.28 g/mol. IUPAC name: 4-(2,3-dihydro-1-benzofuran-5-yl)-1,3-thiazol-2-amine. InChIKey: YREUPBBWTZDQPA-UHFFFAOYSA-N.
| Molecular formula | C11H10N2OS |
|---|---|
| Molecular weight | 218.28 g/mol |
| IUPAC name | 4-(2,3-dihydro-1-benzofuran-5-yl)-1,3-thiazol-2-amine |
| InChIKey | YREUPBBWTZDQPA-UHFFFAOYSA-N |
| SMILES | C1COC2=C1C=C(C=C2)C3=CSC(=N3)N |
Computed by PubChem (NCBI)