CAS 4365-63-3 appears in our catalog under these names: 2-[(4-tert-Butylphenyl)sulfanyl]acetic acid, 98%, 2-((4-(tert-Butyl)phenyl)thio)acetic acid, 98%, 2-((4-tert-Butylphenyl)sulfanyl)acetic Acid. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 100mg, 1g, 250mg, 5g, 2,5g.
2-(4-tert-butylphenyl)sulfanylacetic acid (CAS 4365-63-3) is a chemical compound with the molecular formula C12H16O2S and a molecular weight of 224.32 g/mol. IUPAC name: 2-(4-tert-butylphenyl)sulfanylacetic acid. InChIKey: RVMFURNUVGUONB-UHFFFAOYSA-N.
| Molecular formula | C12H16O2S |
|---|---|
| Molecular weight | 224.32 g/mol |
| IUPAC name | 2-(4-tert-butylphenyl)sulfanylacetic acid |
| InChIKey | RVMFURNUVGUONB-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC=C(C=C1)SCC(=O)O |
Computed by PubChem (NCBI)