CAS 61634-96-6 is the registry number for 1-Mesityl-2-(methylsulfinyl)ethanone, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
2-methylsulfinyl-1-(2,4,6-trimethylphenyl)ethanone (CAS 61634-96-6) is a chemical compound with the molecular formula C12H16O2S and a molecular weight of 224.32 g/mol. IUPAC name: 2-methylsulfinyl-1-(2,4,6-trimethylphenyl)ethanone. InChIKey: NBEDEECEPHSICV-UHFFFAOYSA-N.
| Molecular formula | C12H16O2S |
|---|---|
| Molecular weight | 224.32 g/mol |
| IUPAC name | 2-methylsulfinyl-1-(2,4,6-trimethylphenyl)ethanone |
| InChIKey | NBEDEECEPHSICV-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C(=C1)C)C(=O)CS(=O)C)C |
Computed by PubChem (NCBI)