CAS 4372-67-2 appears in our catalog under these names: 8-Azidoadenosine, 95%, 8-Azidoadenosine, 8-Azido Adenosine, 8-Azidoadenosine, 95.0%. Offered by: Combi-blocks, Creative Peptides, TRC, Biosynth, MedChemExpress. Available pack sizes: 100mg, 250mg, on request, 500mg, 50mg, 1000mg, 5 mg, 25 mg.
(2R,3R,4S,5R)-2-(6-amino-8-azidopurin-9-yl)-5-(hydroxymethyl)oxolane-3,4-diol (CAS 4372-67-2) is a chemical compound with the molecular formula C10H12N8O4 and a molecular weight of 308.25 g/mol. IUPAC name: (2R,3R,4S,5R)-2-(6-amino-8-azidopurin-9-yl)-5-(hydroxymethyl)oxolane-3,4-diol. InChIKey: KYJLJOJCMUFWDY-UUOKFMHZSA-N.
| Molecular formula | C10H12N8O4 |
|---|---|
| Molecular weight | 308.25 g/mol |
| IUPAC name | (2R,3R,4S,5R)-2-(6-amino-8-azidopurin-9-yl)-5-(hydroxymethyl)oxolane-3,4-diol |
| InChIKey | KYJLJOJCMUFWDY-UUOKFMHZSA-N |
| SMILES | C1=NC(=C2C(=N1)N(C(=N2)N=[N+]=[N-])[C@H]3[C@@H]([C@@H]([C@H](O3)CO)O)O)N |
Computed by PubChem (NCBI)