CAS 59587-07-4 appears in our catalog under these names: 2-Azido adenosine, 95%, 2-Azido Adenosine, 2-Azido-adenosine, 99.59%. Offered by: Combi-blocks, TRC, MedChemExpress. Available pack sizes: 100mg, 10mg, 10 mg, 5 mg.
(2R,3R,4S,5R)-2-(6-amino-2-azidopurin-9-yl)-5-(hydroxymethyl)oxolane-3,4-diol (CAS 59587-07-4) is a chemical compound with the molecular formula C10H12N8O4 and a molecular weight of 308.25 g/mol. IUPAC name: (2R,3R,4S,5R)-2-(6-amino-2-azidopurin-9-yl)-5-(hydroxymethyl)oxolane-3,4-diol. InChIKey: BSZZPOARGMTJKQ-UUOKFMHZSA-N.
| Molecular formula | C10H12N8O4 |
|---|---|
| Molecular weight | 308.25 g/mol |
| IUPAC name | (2R,3R,4S,5R)-2-(6-amino-2-azidopurin-9-yl)-5-(hydroxymethyl)oxolane-3,4-diol |
| InChIKey | BSZZPOARGMTJKQ-UUOKFMHZSA-N |
| SMILES | C1=NC2=C(N=C(N=C2N1[C@H]3[C@@H]([C@@H]([C@H](O3)CO)O)O)N=[N+]=[N-])N |
Computed by PubChem (NCBI)