CAS 4374-93-0 is the registry number for Deoxyhumulone. Offered by: TRC. Available pack sizes: 10mg, 1mg.
Deoxyhumulone is a 2-acyl-4,6-diprenylphloroglucinol in which the acyl group is specified as 3-methylbutanoyl. It has a role as a plant metabolite.
Source: ChEBI
| Molecular formula | C21H30O4 |
|---|---|
| Molecular weight | 346.5 g/mol |
| IUPAC name | 3-methyl-1-[2,4,6-trihydroxy-3,5-bis(3-methylbut-2-enyl)phenyl]butan-1-one |
| InChIKey | NQYBQBZOHCACCR-UHFFFAOYSA-N |
| SMILES | CC(C)CC(=O)C1=C(C(=C(C(=C1O)CC=C(C)C)O)CC=C(C)C)O |
Computed by PubChem (NCBI)