CAS 74184-29-5 is the registry number for Cannabitriol. Offered by: Chemat Brand. Available pack sizes: on request.
(9S,10S)-6,6,9-trimethyl-3-pentyl-8,10-dihydro-7H-benzo[c]chromene-1,9,10-triol (CAS 74184-29-5) is a chemical compound with the molecular formula C21H30O4 and a molecular weight of 346.5 g/mol. IUPAC name: (9S,10S)-6,6,9-trimethyl-3-pentyl-8,10-dihydro-7H-benzo[c]chromene-1,9,10-triol. InChIKey: ZLYNXDIDWUWASO-FPOVZHCZSA-N.
| Molecular formula | C21H30O4 |
|---|---|
| Molecular weight | 346.5 g/mol |
| IUPAC name | (9S,10S)-6,6,9-trimethyl-3-pentyl-8,10-dihydro-7H-benzo[c]chromene-1,9,10-triol |
| InChIKey | ZLYNXDIDWUWASO-FPOVZHCZSA-N |
| SMILES | CCCCCC1=CC(=C2C(=C1)OC(C3=C2[C@@H]([C@@](CC3)(C)O)O)(C)C)O |
Computed by PubChem (NCBI)