CAS 438029-94-8 appears in our catalog under these names: Benzothiazol-2-yl-(3,4-dichloro-phenyl)-amine, 95%, N-(3,4-Dichlorophenyl)-1,3-benzothiazol-2-amine, 95%, N-(3,4-Dichlorophenyl)-1,3-benzothiazol-2-amine. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 10g, 250mg, 1g, 100mg, 0,5g.
N-(3,4-dichlorophenyl)-1,3-benzothiazol-2-amine (CAS 438029-94-8) is a chemical compound with the molecular formula C13H8Cl2N2S and a molecular weight of 295.2 g/mol. IUPAC name: N-(3,4-dichlorophenyl)-1,3-benzothiazol-2-amine. InChIKey: DWSXBYLHFRVNOS-UHFFFAOYSA-N.
| Molecular formula | C13H8Cl2N2S |
|---|---|
| Molecular weight | 295.2 g/mol |
| IUPAC name | N-(3,4-dichlorophenyl)-1,3-benzothiazol-2-amine |
| InChIKey | DWSXBYLHFRVNOS-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)N=C(S2)NC3=CC(=C(C=C3)Cl)Cl |
Computed by PubChem (NCBI)