CAS 945533-80-2 is the registry number for 2-(3,4-Dichlorophenyl)benzo[d]thiazol-5-amine, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
2-(3,4-dichlorophenyl)-1,3-benzothiazol-5-amine (CAS 945533-80-2) is a chemical compound with the molecular formula C13H8Cl2N2S and a molecular weight of 295.2 g/mol. IUPAC name: 2-(3,4-dichlorophenyl)-1,3-benzothiazol-5-amine. InChIKey: FFPZXPAZJSIKPH-UHFFFAOYSA-N.
| Molecular formula | C13H8Cl2N2S |
|---|---|
| Molecular weight | 295.2 g/mol |
| IUPAC name | 2-(3,4-dichlorophenyl)-1,3-benzothiazol-5-amine |
| InChIKey | FFPZXPAZJSIKPH-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C2=NC3=C(S2)C=CC(=C3)N)Cl)Cl |
Computed by PubChem (NCBI)