CAS 438029-98-2 appears in our catalog under these names: 2-({(3-(Trifluoromethyl)phenyl)carbamoyl}methoxy)benzoic acid, 2-({(3-(trifluoromethyl)phenyl)carbamoyl}methoxy)benzoic acid, 95%. Offered by: Biosynth, AmBeed. Available pack sizes: 2,5g, 250mg, 5g.
2-[2-oxo-2-[3-(trifluoromethyl)anilino]ethoxy]benzoic acid (CAS 438029-98-2) is a chemical compound with the molecular formula C16H12F3NO4 and a molecular weight of 339.26 g/mol. IUPAC name: 2-[2-oxo-2-[3-(trifluoromethyl)anilino]ethoxy]benzoic acid. InChIKey: XWGJXKXVKFOJBZ-UHFFFAOYSA-N.
| Molecular formula | C16H12F3NO4 |
|---|---|
| Molecular weight | 339.26 g/mol |
| IUPAC name | 2-[2-oxo-2-[3-(trifluoromethyl)anilino]ethoxy]benzoic acid |
| InChIKey | XWGJXKXVKFOJBZ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C(=O)O)OCC(=O)NC2=CC=CC(=C2)C(F)(F)F |
Computed by PubChem (NCBI)