Products 667887-30-1

CAS 667887-30-1 is the registry number for 2-(2-(N-(4-(Trifluoromethoxy)phenyl)carbamoyl)phenyl)acetic acid. Offered by: Biosynth. Available pack sizes: 25g, 10g.

Structural formula: {0} (CAS {1})

2-[2-[[4-(trifluoromethoxy)phenyl]carbamoyl]phenyl]acetic acid (CAS 667887-30-1) is a chemical compound with the molecular formula C16H12F3NO4 and a molecular weight of 339.26 g/mol. IUPAC name: 2-[2-[[4-(trifluoromethoxy)phenyl]carbamoyl]phenyl]acetic acid. InChIKey: PUVXWDSDNZTLSW-UHFFFAOYSA-N.

Identity
Molecular formulaC16H12F3NO4
Molecular weight339.26 g/mol
IUPAC name2-[2-[[4-(trifluoromethoxy)phenyl]carbamoyl]phenyl]acetic acid
InChIKeyPUVXWDSDNZTLSW-UHFFFAOYSA-N
SMILESC1=CC=C(C(=C1)CC(=O)O)C(=O)NC2=CC=C(C=C2)OC(F)(F)F

Computed by PubChem (NCBI)