Products 438198-03-9

CAS 438198-03-9 is the registry number for 4-(2-(2-(4-(tert-Butyl)phenoxy)acetyl)hydrazinyl)-4-oxobutanoic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

4-[2-[2-(4-tert-butylphenoxy)acetyl]hydrazinyl]-4-oxobutanoic acid (CAS 438198-03-9) is a chemical compound with the molecular formula C16H22N2O5 and a molecular weight of 322.36 g/mol. IUPAC name: 4-[2-[2-(4-tert-butylphenoxy)acetyl]hydrazinyl]-4-oxobutanoic acid. InChIKey: SINCDYHERYSVQK-UHFFFAOYSA-N.

Identity
Molecular formulaC16H22N2O5
Molecular weight322.36 g/mol
IUPAC name4-[2-[2-(4-tert-butylphenoxy)acetyl]hydrazinyl]-4-oxobutanoic acid
InChIKeySINCDYHERYSVQK-UHFFFAOYSA-N
SMILESCC(C)(C)C1=CC=C(C=C1)OCC(=O)NNC(=O)CCC(=O)O

Computed by PubChem (NCBI)