CAS 438531-05-6 is the registry number for Ethyl 5-amino-4-(aminocarbonyl)-3-methylthiophene-2-carboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g.
Ethyl 5-amino-4-carbamoyl-3-methylthiophene-2-carboxylate (CAS 438531-05-6) is a chemical compound with the molecular formula C9H12N2O3S and a molecular weight of 228.27 g/mol. IUPAC name: ethyl 5-amino-4-carbamoyl-3-methylthiophene-2-carboxylate. InChIKey: TYAIJSWXQLXFRO-UHFFFAOYSA-N.
| Molecular formula | C9H12N2O3S |
|---|---|
| Molecular weight | 228.27 g/mol |
| IUPAC name | ethyl 5-amino-4-carbamoyl-3-methylthiophene-2-carboxylate |
| InChIKey | TYAIJSWXQLXFRO-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(C(=C(S1)N)C(=O)N)C |
Computed by PubChem (NCBI)