Products 887575-96-4
CAS 887575-96-4 appears in our catalog under these names: 2-[2-(2-Methylpropanamido)-1,3-thiazol-4-yl]acetic acid, 95%, 2-(2-(2-Methylpropanamido)-1,3-thiazol-4-yl)acetic acid, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.
2-[2-(2-methylpropanoylamino)-1,3-thiazol-4-yl]acetic acid (CAS 887575-96-4) is a chemical compound with the molecular formula C9H12N2O3S and a molecular weight of 228.27 g/mol. IUPAC name: 2-[2-(2-methylpropanoylamino)-1,3-thiazol-4-yl]acetic acid. InChIKey: QNOOLSWNJYOGJF-UHFFFAOYSA-N.
| Molecular formula | C9H12N2O3S |
|---|---|
| Molecular weight | 228.27 g/mol |
| IUPAC name | 2-[2-(2-methylpropanoylamino)-1,3-thiazol-4-yl]acetic acid |
| InChIKey | QNOOLSWNJYOGJF-UHFFFAOYSA-N |
| SMILES | CC(C)C(=O)NC1=NC(=CS1)CC(=O)O |
Computed by PubChem (NCBI)