CAS 438575-88-3 is the registry number for NCTT-956. Offered by: MedChemExpress. Available pack sizes: 1 mg, 5 mg.
N-[(8-hydroxy-5-nitroquinolin-7-yl)-thiophen-2-ylmethyl]propanamide (CAS 438575-88-3) is a chemical compound with the molecular formula C17H15N3O4S and a molecular weight of 357.4 g/mol. IUPAC name: N-[(8-hydroxy-5-nitroquinolin-7-yl)-thiophen-2-ylmethyl]propanamide. InChIKey: DEXNORPUTBBNSC-UHFFFAOYSA-N.
| Molecular formula | C17H15N3O4S |
|---|---|
| Molecular weight | 357.4 g/mol |
| IUPAC name | N-[(8-hydroxy-5-nitroquinolin-7-yl)-thiophen-2-ylmethyl]propanamide |
| InChIKey | DEXNORPUTBBNSC-UHFFFAOYSA-N |
| SMILES | CCC(=O)NC(C1=CC=CS1)C2=CC(=C3C=CC=NC3=C2O)[N+](=O)[O-] |
Computed by PubChem (NCBI)