CAS 946386-59-0 is the registry number for N-(aza(2-oxoindolin-3-ylidene)methyl)-2-((4-methylphenyl)sulfonyl)ethanamide. Offered by: Biosynth. Available pack sizes: 250mg.
N-[(2-hydroxy-1H-indol-3-yl)imino]-2-(4-methylphenyl)sulfonylacetamide (CAS 946386-59-0) is a chemical compound with the molecular formula C17H15N3O4S and a molecular weight of 357.4 g/mol. IUPAC name: N-[(2-hydroxy-1H-indol-3-yl)imino]-2-(4-methylphenyl)sulfonylacetamide. InChIKey: TVMFZWXXKXBLRH-UHFFFAOYSA-N.
| Molecular formula | C17H15N3O4S |
|---|---|
| Molecular weight | 357.4 g/mol |
| IUPAC name | N-[(2-hydroxy-1H-indol-3-yl)imino]-2-(4-methylphenyl)sulfonylacetamide |
| InChIKey | TVMFZWXXKXBLRH-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)CC(=O)N=NC2=C(NC3=CC=CC=C32)O |
Computed by PubChem (NCBI)