CAS 438633-05-7 appears in our catalog under these names: L-Cystine (monohydrochloride), L-Cystine hydrochloride, 98%. Offered by: MedChemExpress, Fluorochem. Available pack sizes: Get quote, 10g, 25g, 100g.
(2R)-2-amino-3-[[(2R)-2-amino-2-carboxyethyl]disulfanyl]propanoic acid;hydrochloride (CAS 438633-05-7) is a chemical compound with the molecular formula C6H13ClN2O4S2 and a molecular weight of 276.8 g/mol. IUPAC name: (2R)-2-amino-3-[[(2R)-2-amino-2-carboxyethyl]disulfanyl]propanoic acid;hydrochloride. InChIKey: IOCJWNPYGRVHLN-MMALYQPHSA-N.
| Molecular formula | C6H13ClN2O4S2 |
|---|---|
| Molecular weight | 276.8 g/mol |
| IUPAC name | (2R)-2-amino-3-[[(2R)-2-amino-2-carboxyethyl]disulfanyl]propanoic acid;hydrochloride |
| InChIKey | IOCJWNPYGRVHLN-MMALYQPHSA-N |
| SMILES | C([C@@H](C(=O)O)N)SSC[C@@H](C(=O)O)N.Cl |
Computed by PubChem (NCBI)