CAS 55533-01-2 is the registry number for 3,3'-Disulfanediylbis(2-aminopropanoic acid) hydrochloride, 95+%. Offered by: Chemat Brand. Available pack sizes: on request.
2-amino-3-[(2-amino-2-carboxyethyl)disulfanyl]propanoic acid;hydrochloride (CAS 55533-01-2) is a chemical compound with the molecular formula C6H13ClN2O4S2 and a molecular weight of 276.8 g/mol. IUPAC name: 2-amino-3-[(2-amino-2-carboxyethyl)disulfanyl]propanoic acid;hydrochloride. InChIKey: IOCJWNPYGRVHLN-UHFFFAOYSA-N.
| Molecular formula | C6H13ClN2O4S2 |
|---|---|
| Molecular weight | 276.8 g/mol |
| IUPAC name | 2-amino-3-[(2-amino-2-carboxyethyl)disulfanyl]propanoic acid;hydrochloride |
| InChIKey | IOCJWNPYGRVHLN-UHFFFAOYSA-N |
| SMILES | C(C(C(=O)O)N)SSCC(C(=O)O)N.Cl |
Computed by PubChem (NCBI)