Products 4391-99-5
CAS 4391-99-5 is the registry number for Ethyl 5-formyl-3,4-dimethyl-1H-pyrrole-2-carboxylate. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
Ethyl 5-formyl-3,4-dimethyl-1H-pyrrole-2-carboxylate (CAS 4391-99-5) is a chemical compound with the molecular formula C10H13NO3 and a molecular weight of 195.21 g/mol. IUPAC name: ethyl 5-formyl-3,4-dimethyl-1H-pyrrole-2-carboxylate. InChIKey: JOTQAIVFNWNMHR-UHFFFAOYSA-N.
| Molecular formula | C10H13NO3 |
|---|---|
| Molecular weight | 195.21 g/mol |
| IUPAC name | ethyl 5-formyl-3,4-dimethyl-1H-pyrrole-2-carboxylate |
| InChIKey | JOTQAIVFNWNMHR-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(C(=C(N1)C=O)C)C |
Computed by PubChem (NCBI)