CAS 439106-66-8 appears in our catalog under these names: 4-(3,5-Difluorophenyl)-1H-pyrazole, 97%, 4-(3,5-Difluorophenyl)-1H-pyrazole. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
4-(3,5-difluorophenyl)-1H-pyrazole (CAS 439106-66-8) is a chemical compound with the molecular formula C9H6F2N2 and a molecular weight of 180.15 g/mol. IUPAC name: 4-(3,5-difluorophenyl)-1H-pyrazole. InChIKey: KNSJJZKQRHFLRS-UHFFFAOYSA-N.
| Molecular formula | C9H6F2N2 |
|---|---|
| Molecular weight | 180.15 g/mol |
| IUPAC name | 4-(3,5-difluorophenyl)-1H-pyrazole |
| InChIKey | KNSJJZKQRHFLRS-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C=C1F)F)C2=CNN=C2 |
Computed by PubChem (NCBI)