CAS 439106-87-3 appears in our catalog under these names: 2-(1H-Pyrazol-4-yl)quinoline, 95+%, 2-(1H-Pyrazol-4-yl)quinoline, 99%. Offered by: AmBeed, Fluorochem. Available pack sizes: 10g, 1g, 5g.
2-(1H-pyrazol-4-yl)quinoline (CAS 439106-87-3) is a chemical compound with the molecular formula C12H9N3 and a molecular weight of 195.22 g/mol. IUPAC name: 2-(1H-pyrazol-4-yl)quinoline. InChIKey: AEABRQVZLJNLMP-UHFFFAOYSA-N.
| Molecular formula | C12H9N3 |
|---|---|
| Molecular weight | 195.22 g/mol |
| IUPAC name | 2-(1H-pyrazol-4-yl)quinoline |
| InChIKey | AEABRQVZLJNLMP-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=CC(=N2)C3=CNN=C3 |
Computed by PubChem (NCBI)