CAS 439107-12-7 is the registry number for 3-(Quinolin-3-yl)propanal, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
3-quinolin-3-ylpropanal (CAS 439107-12-7) is a chemical compound with the molecular formula C12H11NO and a molecular weight of 185.22 g/mol. IUPAC name: 3-quinolin-3-ylpropanal. InChIKey: WAFJXZHEKHZBSY-UHFFFAOYSA-N.
| Molecular formula | C12H11NO |
|---|---|
| Molecular weight | 185.22 g/mol |
| IUPAC name | 3-quinolin-3-ylpropanal |
| InChIKey | WAFJXZHEKHZBSY-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=C(C=N2)CCC=O |
Computed by PubChem (NCBI)