Products 4395-36-2
CAS 4395-36-2 is the registry number for (2R,3R,5S)-5-(hydroxymethyl)-2-methoxy-tetrahydrofuran-3-ol, 93%. Offered by: Chemat. Available pack sizes: 1g, 5g.
(2R,3R,5S)-5-(hydroxymethyl)-2-methoxyoxolan-3-ol (CAS 4395-36-2) is a chemical compound with the molecular formula C6H12O4 and a molecular weight of 148.16 g/mol. IUPAC name: (2R,3R,5S)-5-(hydroxymethyl)-2-methoxyoxolan-3-ol. InChIKey: XFLOJOXQDZMCRP-KVQBGUIXSA-N.
| Molecular formula | C6H12O4 |
|---|---|
| Molecular weight | 148.16 g/mol |
| IUPAC name | (2R,3R,5S)-5-(hydroxymethyl)-2-methoxyoxolan-3-ol |
| InChIKey | XFLOJOXQDZMCRP-KVQBGUIXSA-N |
| SMILES | CO[C@H]1[C@@H](C[C@H](O1)CO)O |
Computed by PubChem (NCBI)