CAS 863396-35-4 appears in our catalog under these names: (3R,4S)-6-Methoxytetrahydro-2h-pyran-3,4-diol, 95%, (3R,4S)–6–methoxytetrahydro–2H–pyran–3,4–diol, Methyl 2-deoxy-D-ribopyranoside. Offered by: Combi-blocks, GLPBio, Biosynth. Available pack sizes: 250mg, 5000mg, 10000mg.
(3R,4S)-6-methoxyoxane-3,4-diol (CAS 863396-35-4) is a chemical compound with the molecular formula C6H12O4 and a molecular weight of 148.16 g/mol. IUPAC name: (3R,4S)-6-methoxyoxane-3,4-diol. InChIKey: CYLGOSOYSUHPCY-YRZWDFBDSA-N.
| Molecular formula | C6H12O4 |
|---|---|
| Molecular weight | 148.16 g/mol |
| IUPAC name | (3R,4S)-6-methoxyoxane-3,4-diol |
| InChIKey | CYLGOSOYSUHPCY-YRZWDFBDSA-N |
| SMILES | COC1C[C@@H]([C@@H](CO1)O)O |
Computed by PubChem (NCBI)