CAS 446251-73-6 appears in our catalog under these names: Methyl-2-deoxy-l-erythro-pentofuranose, 95%, (2S,3R)–2–(hydroxymethyl)–5–methoxytetrahydrofuran–3–ol, Methyl 2-deoxy-L-ribofuranoside. Offered by: Combi-blocks, GLPBio, Biosynth. Available pack sizes: 1g, 250mg, 0,5g, 2g, 10g, 5g.
(2S,3R)-2-(hydroxymethyl)-5-methoxyoxolan-3-ol (CAS 446251-73-6) is a chemical compound with the molecular formula C6H12O4 and a molecular weight of 148.16 g/mol. IUPAC name: (2S,3R)-2-(hydroxymethyl)-5-methoxyoxolan-3-ol. InChIKey: NVGJZDFWPSOTHM-XSYQQOMZSA-N.
| Molecular formula | C6H12O4 |
|---|---|
| Molecular weight | 148.16 g/mol |
| IUPAC name | (2S,3R)-2-(hydroxymethyl)-5-methoxyoxolan-3-ol |
| InChIKey | NVGJZDFWPSOTHM-XSYQQOMZSA-N |
| SMILES | COC1C[C@H]([C@@H](O1)CO)O |
Computed by PubChem (NCBI)