Products 439692-54-3
CAS 439692-54-3 is the registry number for 6-Tert-Butyl-3H-Thieno[2,3-D]Pyrimidin-4-One, 97%. Offered by: Chemat. Available pack sizes: 1g, 5g.
6-tert-butyl-3H-thieno[2,3-d]pyrimidin-4-one (CAS 439692-54-3) is a chemical compound with the molecular formula C10H12N2OS and a molecular weight of 208.28 g/mol. IUPAC name: 6-tert-butyl-3H-thieno[2,3-d]pyrimidin-4-one. InChIKey: VXRZEVXONXRPQE-UHFFFAOYSA-N.
| Molecular formula | C10H12N2OS |
|---|---|
| Molecular weight | 208.28 g/mol |
| IUPAC name | 6-tert-butyl-3H-thieno[2,3-d]pyrimidin-4-one |
| InChIKey | VXRZEVXONXRPQE-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC2=C(S1)N=CNC2=O |
Computed by PubChem (NCBI)