CAS 439809-43-5 appears in our catalog under these names: 5-Bromo-4-chloro-3-indoxyl choline phosphate, 95%, 5-Bromo-4-chloro-3-indoxyl choline phosphate, 5-bromo-4-chloro-3-indoxyl choline phosphate, 98%, 98%. Offered by: Combi-blocks, Biosynth, Chemat. Available pack sizes: 1g, 250mg, 5g, 0,5g, 2g, 10g, 500mg.
(5-bromo-4-chloro-1H-indol-3-yl) 2-(trimethylazaniumyl)ethyl phosphate (CAS 439809-43-5) is a chemical compound with the molecular formula C13H17BrClN2O4P and a molecular weight of 411.61 g/mol. IUPAC name: (5-bromo-4-chloro-1H-indol-3-yl) 2-(trimethylazaniumyl)ethyl phosphate. InChIKey: BFXURLIMPJNXOL-UHFFFAOYSA-N.
| Molecular formula | C13H17BrClN2O4P |
|---|---|
| Molecular weight | 411.61 g/mol |
| IUPAC name | (5-bromo-4-chloro-1H-indol-3-yl) 2-(trimethylazaniumyl)ethyl phosphate |
| InChIKey | BFXURLIMPJNXOL-UHFFFAOYSA-N |
| SMILES | C[N+](C)(C)CCOP(=O)([O-])OC1=CNC2=C1C(=C(C=C2)Br)Cl |
Computed by PubChem (NCBI)