Products 641571-93-9

CAS 641571-93-9 is the registry number for 5-Bromo-6-chloro-3-indoxyl choline phosphate. Offered by: Biosynth. Available pack sizes: 100mg, 50mg, 250mg.

Structural formula: {0} (CAS {1})

(5-bromo-6-chloro-1H-indol-3-yl) 2-(trimethylazaniumyl)ethyl phosphate (CAS 641571-93-9) is a chemical compound with the molecular formula C13H17BrClN2O4P and a molecular weight of 411.61 g/mol. IUPAC name: (5-bromo-6-chloro-1H-indol-3-yl) 2-(trimethylazaniumyl)ethyl phosphate. InChIKey: NZAYYRWXAYVGMD-UHFFFAOYSA-N.

Identity
Molecular formulaC13H17BrClN2O4P
Molecular weight411.61 g/mol
IUPAC name(5-bromo-6-chloro-1H-indol-3-yl) 2-(trimethylazaniumyl)ethyl phosphate
InChIKeyNZAYYRWXAYVGMD-UHFFFAOYSA-N
SMILESC[N+](C)(C)CCOP(=O)([O-])OC1=CNC2=CC(=C(C=C21)Br)Cl

Computed by PubChem (NCBI)