CAS 641571-93-9 is the registry number for 5-Bromo-6-chloro-3-indoxyl choline phosphate. Offered by: Biosynth. Available pack sizes: 100mg, 50mg, 250mg.
(5-bromo-6-chloro-1H-indol-3-yl) 2-(trimethylazaniumyl)ethyl phosphate (CAS 641571-93-9) is a chemical compound with the molecular formula C13H17BrClN2O4P and a molecular weight of 411.61 g/mol. IUPAC name: (5-bromo-6-chloro-1H-indol-3-yl) 2-(trimethylazaniumyl)ethyl phosphate. InChIKey: NZAYYRWXAYVGMD-UHFFFAOYSA-N.
| Molecular formula | C13H17BrClN2O4P |
|---|---|
| Molecular weight | 411.61 g/mol |
| IUPAC name | (5-bromo-6-chloro-1H-indol-3-yl) 2-(trimethylazaniumyl)ethyl phosphate |
| InChIKey | NZAYYRWXAYVGMD-UHFFFAOYSA-N |
| SMILES | C[N+](C)(C)CCOP(=O)([O-])OC1=CNC2=CC(=C(C=C21)Br)Cl |
Computed by PubChem (NCBI)