CAS 440327-19-5 is the registry number for 3-(3,4-Dimethylphenyl)-2-thioxo-2,3-dihydrothieno[3,2-d]pyrimidin-4(1h)-one, 90%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
3-(3,4-dimethylphenyl)-2-sulfanylidene-1H-thieno[3,2-d]pyrimidin-4-one (CAS 440327-19-5) is a chemical compound with the molecular formula C14H12N2OS2 and a molecular weight of 288.4 g/mol. IUPAC name: 3-(3,4-dimethylphenyl)-2-sulfanylidene-1H-thieno[3,2-d]pyrimidin-4-one. InChIKey: ZBXZYKCIJMJLKI-UHFFFAOYSA-N.
| Molecular formula | C14H12N2OS2 |
|---|---|
| Molecular weight | 288.4 g/mol |
| IUPAC name | 3-(3,4-dimethylphenyl)-2-sulfanylidene-1H-thieno[3,2-d]pyrimidin-4-one |
| InChIKey | ZBXZYKCIJMJLKI-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)N2C(=O)C3=C(C=CS3)NC2=S)C |
Computed by PubChem (NCBI)