Products 92148-90-8
CAS 92148-90-8 is the registry number for 3-ethyl-5-(indol-3-ylmethylene)-2-thioxo-1,3-thiazolidin-4-one. Offered by: Biosynth. Available pack sizes: 25g, 10g.
3-ethyl-4-hydroxy-5-[(E)-indol-3-ylidenemethyl]-1,3-thiazole-2-thione (CAS 92148-90-8) is a chemical compound with the molecular formula C14H12N2OS2 and a molecular weight of 288.4 g/mol. IUPAC name: 3-ethyl-4-hydroxy-5-[(E)-indol-3-ylidenemethyl]-1,3-thiazole-2-thione. InChIKey: BYZDFSNRACWQHG-CLFYSBASSA-N.
| Molecular formula | C14H12N2OS2 |
|---|---|
| Molecular weight | 288.4 g/mol |
| IUPAC name | 3-ethyl-4-hydroxy-5-[(E)-indol-3-ylidenemethyl]-1,3-thiazole-2-thione |
| InChIKey | BYZDFSNRACWQHG-CLFYSBASSA-N |
| SMILES | CCN1C(=C(SC1=S)/C=C\2/C=NC3=CC=CC=C32)O |
Computed by PubChem (NCBI)