CAS 441016-97-3 appears in our catalog under these names: (3AR,5R,6aS)-5-methoxy-octahydropentalen-2-one, 95%, 5-Methoxy-octahydropentalen-2-one. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
(3aR,6aS)-5-methoxy-3,3a,4,5,6,6a-hexahydro-1H-pentalen-2-one (CAS 441016-97-3) is a chemical compound with the molecular formula C9H14O2 and a molecular weight of 154.21 g/mol. IUPAC name: (3aR,6aS)-5-methoxy-3,3a,4,5,6,6a-hexahydro-1H-pentalen-2-one. InChIKey: JUZGULRWIIOVOK-AVSFMBPQSA-N.
| Molecular formula | C9H14O2 |
|---|---|
| Molecular weight | 154.21 g/mol |
| IUPAC name | (3aR,6aS)-5-methoxy-3,3a,4,5,6,6a-hexahydro-1H-pentalen-2-one |
| InChIKey | JUZGULRWIIOVOK-AVSFMBPQSA-N |
| SMILES | COC1C[C@@H]2CC(=O)C[C@@H]2C1 |
Computed by PubChem (NCBI)