Products 441285-55-8
CAS 441285-55-8 appears in our catalog under these names: Fructose Glycerol Derivative 4, Glucosamine Hydrochloride Impurity 20. Offered by: Chemat Brand, Hubei YoungXin. Available pack sizes: on request, 100mg, 10mg, 200mg, 25mg, 50mg.
(E,5S)-5,6-dihydroxy-2-oxohex-3-enal (CAS 441285-55-8) is a chemical compound with the molecular formula C6H8O4 and a molecular weight of 144.12 g/mol. IUPAC name: (E,5S)-5,6-dihydroxy-2-oxohex-3-enal. InChIKey: YSSNFXZGTOLNNX-IPWVHJGXSA-N.
| Molecular formula | C6H8O4 |
|---|---|
| Molecular weight | 144.12 g/mol |
| IUPAC name | (E,5S)-5,6-dihydroxy-2-oxohex-3-enal |
| InChIKey | YSSNFXZGTOLNNX-IPWVHJGXSA-N |
| SMILES | C([C@H](/C=C/C(=O)C=O)O)O |
Computed by PubChem (NCBI)