CAS 91602-06-1 is the registry number for Fructose Glycerol Derivative 5. Offered by: Chemat Brand. Available pack sizes: on request.
(Z,5S)-5,6-dihydroxy-2-oxohex-3-enal (CAS 91602-06-1) is a chemical compound with the molecular formula C6H8O4 and a molecular weight of 144.12 g/mol. IUPAC name: (Z,5S)-5,6-dihydroxy-2-oxohex-3-enal. InChIKey: YSSNFXZGTOLNNX-UDIFJAKLSA-N.
| Molecular formula | C6H8O4 |
|---|---|
| Molecular weight | 144.12 g/mol |
| IUPAC name | (Z,5S)-5,6-dihydroxy-2-oxohex-3-enal |
| InChIKey | YSSNFXZGTOLNNX-UDIFJAKLSA-N |
| SMILES | C([C@H](/C=C\C(=O)C=O)O)O |
Computed by PubChem (NCBI)