CAS 441745-96-6 is the registry number for N-(4-((4-(2-furylcarbonyl)piperazinyl)sulfonyl)phenyl)ethanamide. Offered by: Biosynth. Available pack sizes: 250mg.
N-[4-[4-(furan-2-carbonyl)piperazin-1-yl]sulfonylphenyl]acetamide (CAS 441745-96-6) is a chemical compound with the molecular formula C17H19N3O5S and a molecular weight of 377.4 g/mol. IUPAC name: N-[4-[4-(furan-2-carbonyl)piperazin-1-yl]sulfonylphenyl]acetamide. InChIKey: QCCJGASCIQWJHN-UHFFFAOYSA-N.
| Molecular formula | C17H19N3O5S |
|---|---|
| Molecular weight | 377.4 g/mol |
| IUPAC name | N-[4-[4-(furan-2-carbonyl)piperazin-1-yl]sulfonylphenyl]acetamide |
| InChIKey | QCCJGASCIQWJHN-UHFFFAOYSA-N |
| SMILES | CC(=O)NC1=CC=C(C=C1)S(=O)(=O)N2CCN(CC2)C(=O)C3=CC=CO3 |
Computed by PubChem (NCBI)