CAS 748776-35-4 is the registry number for 4-Methoxy-3-{(4-(pyridin-2-yl)piperazin-1-yl)sulfonyl}benzoic acid, 95%. Offered by: AmBeed. Available pack sizes: 5g.
4-methoxy-3-(4-pyridin-2-ylpiperazin-1-yl)sulfonylbenzoic acid (CAS 748776-35-4) is a chemical compound with the molecular formula C17H19N3O5S and a molecular weight of 377.4 g/mol. IUPAC name: 4-methoxy-3-(4-pyridin-2-ylpiperazin-1-yl)sulfonylbenzoic acid. InChIKey: AWDBPBCRHQVNHE-UHFFFAOYSA-N.
| Molecular formula | C17H19N3O5S |
|---|---|
| Molecular weight | 377.4 g/mol |
| IUPAC name | 4-methoxy-3-(4-pyridin-2-ylpiperazin-1-yl)sulfonylbenzoic acid |
| InChIKey | AWDBPBCRHQVNHE-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)C(=O)O)S(=O)(=O)N2CCN(CC2)C3=CC=CC=N3 |
Computed by PubChem (NCBI)