CAS 443-75-4 appears in our catalog under these names: 6–Fluoroindole–3–acetic acid, 6-Fluoroindole-3-acetic acid, 2-(6-Fluoro-1H-indol-3-yl)acetic acid 98%, 2-(6-Fluoro-1H-Indol-3-Yl)Acetic Acid, 98%, 98%, 6-Fluoroindole-3-acetic acid, 98%. Offered by: GLPBio, Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 2g, 5g, 100mg, 10g.
2-(6-fluoro-1H-indol-3-yl)acetic acid (CAS 443-75-4) is a chemical compound with the molecular formula C10H8FNO2 and a molecular weight of 193.17 g/mol. IUPAC name: 2-(6-fluoro-1H-indol-3-yl)acetic acid. InChIKey: OOEZASHYQRURRT-UHFFFAOYSA-N.
| Molecular formula | C10H8FNO2 |
|---|---|
| Molecular weight | 193.17 g/mol |
| IUPAC name | 2-(6-fluoro-1H-indol-3-yl)acetic acid |
| InChIKey | OOEZASHYQRURRT-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1F)NC=C2CC(=O)O |
Computed by PubChem (NCBI)