CAS 444057-65-2 is the registry number for Ertapenem Impurity 12 HCl. Offered by: Chemat Brand. Available pack sizes: on request.
3-[[(2S,4R)-4-hydroxypyrrolidine-2-carbonyl]amino]benzoic acid;hydrochloride (CAS 444057-65-2) is a chemical compound with the molecular formula C12H15ClN2O4 and a molecular weight of 286.71 g/mol. IUPAC name: 3-[[(2S,4R)-4-hydroxypyrrolidine-2-carbonyl]amino]benzoic acid;hydrochloride. InChIKey: RYWICTGWMAAHAJ-UXQCFNEQSA-N.
| Molecular formula | C12H15ClN2O4 |
|---|---|
| Molecular weight | 286.71 g/mol |
| IUPAC name | 3-[[(2S,4R)-4-hydroxypyrrolidine-2-carbonyl]amino]benzoic acid;hydrochloride |
| InChIKey | RYWICTGWMAAHAJ-UXQCFNEQSA-N |
| SMILES | C1[C@H](CN[C@@H]1C(=O)NC2=CC=CC(=C2)C(=O)O)O.Cl |
Computed by PubChem (NCBI)