CAS 1346446-94-3 is the registry number for tert-Butyl (7-chloro-2,3-dihydro-[1,4]dioxino[2,3-b]pyridin-6-yl)carbamate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg, 100mg.
Tert-butyl N-(7-chloro-2,3-dihydro-[1,4]dioxino[2,3-b]pyridin-6-yl)carbamate (CAS 1346446-94-3) is a chemical compound with the molecular formula C12H15ClN2O4 and a molecular weight of 286.71 g/mol. IUPAC name: tert-butyl N-(7-chloro-2,3-dihydro-[1,4]dioxino[2,3-b]pyridin-6-yl)carbamate. InChIKey: SYDXKMMBOQVVSA-UHFFFAOYSA-N.
| Molecular formula | C12H15ClN2O4 |
|---|---|
| Molecular weight | 286.71 g/mol |
| IUPAC name | tert-butyl N-(7-chloro-2,3-dihydro-[1,4]dioxino[2,3-b]pyridin-6-yl)carbamate |
| InChIKey | SYDXKMMBOQVVSA-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC1=C(C=C2C(=N1)OCCO2)Cl |
Computed by PubChem (NCBI)