Products 2057426-35-2
CAS 2057426-35-2 is the registry number for Methyl 5-((tert-butoxycarbonyl)amino)-6-chloronicotinate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl 6-chloro-5-[(2-methylpropan-2-yl)oxycarbonylamino]pyridine-3-carboxylate (CAS 2057426-35-2) is a chemical compound with the molecular formula C12H15ClN2O4 and a molecular weight of 286.71 g/mol. IUPAC name: methyl 6-chloro-5-[(2-methylpropan-2-yl)oxycarbonylamino]pyridine-3-carboxylate. InChIKey: NTPGRBMXJVDKBE-UHFFFAOYSA-N.
| Molecular formula | C12H15ClN2O4 |
|---|---|
| Molecular weight | 286.71 g/mol |
| IUPAC name | methyl 6-chloro-5-[(2-methylpropan-2-yl)oxycarbonylamino]pyridine-3-carboxylate |
| InChIKey | NTPGRBMXJVDKBE-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC1=C(N=CC(=C1)C(=O)OC)Cl |
Computed by PubChem (NCBI)