Products 444343-41-3
CAS 444343-41-3 appears in our catalog under these names: 5-(Naphthalen-2-yl)isophthalic acid, 98%, 98%, 5-(Naphthalen-2-yl)isophthalicacid, 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
5-naphthalen-2-ylbenzene-1,3-dicarboxylic acid (CAS 444343-41-3) is a chemical compound with the molecular formula C18H12O4 and a molecular weight of 292.3 g/mol. IUPAC name: 5-naphthalen-2-ylbenzene-1,3-dicarboxylic acid. InChIKey: SUZSEOPSSUZGPS-UHFFFAOYSA-N.
| Molecular formula | C18H12O4 |
|---|---|
| Molecular weight | 292.3 g/mol |
| IUPAC name | 5-naphthalen-2-ylbenzene-1,3-dicarboxylic acid |
| InChIKey | SUZSEOPSSUZGPS-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C=C(C=CC2=C1)C3=CC(=CC(=C3)C(=O)O)C(=O)O |
Computed by PubChem (NCBI)