Products 455321-49-0

CAS 455321-49-0 is the registry number for methyl 4-((1,3-dioxoindan-2-ylidene)methyl)benzoate. Offered by: Biosynth. Available pack sizes: 1000mg, 500mg, 2000mg.

Structural formula: {0} (CAS {1})

Methyl 4-[(1,3-dioxoinden-2-ylidene)methyl]benzoate (CAS 455321-49-0) is a chemical compound with the molecular formula C18H12O4 and a molecular weight of 292.3 g/mol. IUPAC name: methyl 4-[(1,3-dioxoinden-2-ylidene)methyl]benzoate. InChIKey: AIXJJLCDYFYXKS-UHFFFAOYSA-N.

Identity
Molecular formulaC18H12O4
Molecular weight292.3 g/mol
IUPAC namemethyl 4-[(1,3-dioxoinden-2-ylidene)methyl]benzoate
InChIKeyAIXJJLCDYFYXKS-UHFFFAOYSA-N
SMILESCOC(=O)C1=CC=C(C=C1)C=C2C(=O)C3=CC=CC=C3C2=O

Computed by PubChem (NCBI)