Products 445007-59-0
CAS 445007-59-0 is the registry number for AK963/40708899. Offered by: MedChemExpress. Available pack sizes: Get quote.
1-(2,5-dimethylphenyl)-3-(3-methylphenyl)urea (CAS 445007-59-0) is a chemical compound with the molecular formula C16H18N2O and a molecular weight of 254.33 g/mol. IUPAC name: 1-(2,5-dimethylphenyl)-3-(3-methylphenyl)urea. InChIKey: BAIIKMBZYOWCBK-UHFFFAOYSA-N.
| Molecular formula | C16H18N2O |
|---|---|
| Molecular weight | 254.33 g/mol |
| IUPAC name | 1-(2,5-dimethylphenyl)-3-(3-methylphenyl)urea |
| InChIKey | BAIIKMBZYOWCBK-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC=C1)NC(=O)NC2=C(C=CC(=C2)C)C |
Computed by PubChem (NCBI)