CAS 445018-80-4 appears in our catalog under these names: 4-Fluoro-3-propylbenzoic acid, 95%, 4-Fluoro-3-propylbenzoic acid 95%. Offered by: AmBeed. Available pack sizes: 250mg, 1g.
4-fluoro-3-propylbenzoic acid (CAS 445018-80-4) is a chemical compound with the molecular formula C10H11FO2 and a molecular weight of 182.19 g/mol. IUPAC name: 4-fluoro-3-propylbenzoic acid. InChIKey: CWGCZLDQVNFBMO-UHFFFAOYSA-N.
| Molecular formula | C10H11FO2 |
|---|---|
| Molecular weight | 182.19 g/mol |
| IUPAC name | 4-fluoro-3-propylbenzoic acid |
| InChIKey | CWGCZLDQVNFBMO-UHFFFAOYSA-N |
| SMILES | CCCC1=C(C=CC(=C1)C(=O)O)F |
Computed by PubChem (NCBI)