Products 445310-00-9
CAS 445310-00-9 is the registry number for cis-2-Boc-5-Cbz-octahydropyrrolo[3,4-c]pyrrole, >95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g.
2-O-benzyl 5-O-tert-butyl (3aS,6aR)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-2,5-dicarboxylate (CAS 445310-00-9) is a chemical compound with the molecular formula C19H26N2O4 and a molecular weight of 346.4 g/mol. IUPAC name: 2-O-benzyl 5-O-tert-butyl (3aS,6aR)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-2,5-dicarboxylate. InChIKey: HUYXEFHJWLCEGL-IYBDPMFKSA-N.
| Molecular formula | C19H26N2O4 |
|---|---|
| Molecular weight | 346.4 g/mol |
| IUPAC name | 2-O-benzyl 5-O-tert-butyl (3aS,6aR)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-2,5-dicarboxylate |
| InChIKey | HUYXEFHJWLCEGL-IYBDPMFKSA-N |
| SMILES | CC(C)(C)OC(=O)N1C[C@H]2CN(C[C@H]2C1)C(=O)OCC3=CC=CC=C3 |
Computed by PubChem (NCBI)