Products 446019-94-9
CAS 446019-94-9 is the registry number for N,N-Diisopropyl-4-methoxypicolinamide, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
4-methoxy-N,N-di(propan-2-yl)pyridine-2-carboxamide (CAS 446019-94-9) is a chemical compound with the molecular formula C13H20N2O2 and a molecular weight of 236.31 g/mol. IUPAC name: 4-methoxy-N,N-di(propan-2-yl)pyridine-2-carboxamide. InChIKey: YFXZFQIMLQYBCM-UHFFFAOYSA-N.
| Molecular formula | C13H20N2O2 |
|---|---|
| Molecular weight | 236.31 g/mol |
| IUPAC name | 4-methoxy-N,N-di(propan-2-yl)pyridine-2-carboxamide |
| InChIKey | YFXZFQIMLQYBCM-UHFFFAOYSA-N |
| SMILES | CC(C)N(C(C)C)C(=O)C1=NC=CC(=C1)OC |
Computed by PubChem (NCBI)